Products 221170-22-5
CAS 221170-22-5 is the registry number for 5-(2-Azidoethyl)pyrimidine-2,4(1H,3H)-dione. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 1000mg.
5-(2-azidoethyl)-1H-pyrimidine-2,4-dione (CAS 221170-22-5) is a chemical compound with the molecular formula C6H7N5O2 and a molecular weight of 181.15 g/mol. IUPAC name: 5-(2-azidoethyl)-1H-pyrimidine-2,4-dione. InChIKey: CGDHLCLUWHFNSJ-UHFFFAOYSA-N.
| Molecular formula | C6H7N5O2 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 5-(2-azidoethyl)-1H-pyrimidine-2,4-dione |
| InChIKey | CGDHLCLUWHFNSJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1)CCN=[N+]=[N-] |
Computed by PubChem (NCBI)