CAS 1546495-80-0 appears in our catalog under these names: Zolpidem Impurity 10, Zolpidem Impurity 39. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
6-methyl-2-(3-methylphenyl)imidazo[1,2-a]pyridine (CAS 1546495-80-0) is a chemical compound with the molecular formula C15H14N2 and a molecular weight of 222.28 g/mol. IUPAC name: 6-methyl-2-(3-methylphenyl)imidazo[1,2-a]pyridine. InChIKey: NRDMHGSMLIFPAQ-UHFFFAOYSA-N.
| Molecular formula | C15H14N2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 6-methyl-2-(3-methylphenyl)imidazo[1,2-a]pyridine |
| InChIKey | NRDMHGSMLIFPAQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CN3C=C(C=CC3=N2)C |
Computed by PubChem (NCBI)