CAS 65964-61-6 appears in our catalog under these names: 7-Methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine, 95%, Zolpidem tartrate Impurity 3, 7-Methyl-2-(p-tolyl)imidazo[1,2-a]pyridine 97%, 7-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine, ≥95%, ≥95%, 7-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine. Offered by: Combi-blocks, Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g, on request, 100mg.
7-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine (CAS 65964-61-6) is a chemical compound with the molecular formula C15H14N2 and a molecular weight of 222.28 g/mol. IUPAC name: 7-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine. InChIKey: LYFJFTUNFSUVKC-UHFFFAOYSA-N.
| Molecular formula | C15H14N2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 7-methyl-2-(4-methylphenyl)imidazo[1,2-a]pyridine |
| InChIKey | LYFJFTUNFSUVKC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CN3C=CC(=CC3=N2)C |
Computed by PubChem (NCBI)