Products 1546686-09-2
CAS 1546686-09-2 is the registry number for 7-Bromo-5-fluoro-1,2-dihydroisoquinolin-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-bromo-5-fluoro-2H-isoquinolin-1-one (CAS 1546686-09-2) is a chemical compound with the molecular formula C9H5BrFNO and a molecular weight of 242.04 g/mol. IUPAC name: 7-bromo-5-fluoro-2H-isoquinolin-1-one. InChIKey: HZHDHHUMWYUPOV-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | 7-bromo-5-fluoro-2H-isoquinolin-1-one |
| InChIKey | HZHDHHUMWYUPOV-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C2=C1C(=CC(=C2)Br)F |
Computed by PubChem (NCBI)