CAS 154712-47-7 appears in our catalog under these names: Methyl 2-(chlorosulfonyl)-4-nitrobenzoate, 95%, methyl 2-(chlorosulfonyl)-4-nitrobenzoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
Methyl 2-chlorosulfonyl-4-nitrobenzoate (CAS 154712-47-7) is a chemical compound with the molecular formula C8H6ClNO6S and a molecular weight of 279.65 g/mol. IUPAC name: methyl 2-chlorosulfonyl-4-nitrobenzoate. InChIKey: MLTJLRTUMSHHNJ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO6S |
|---|---|
| Molecular weight | 279.65 g/mol |
| IUPAC name | methyl 2-chlorosulfonyl-4-nitrobenzoate |
| InChIKey | MLTJLRTUMSHHNJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)Cl |
Computed by PubChem (NCBI)