Products 2183910-38-3
CAS 2183910-38-3 is the registry number for 2-Chloro-5-(methylsulfonyl)-3-nitrobenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-5-methylsulfonyl-3-nitrobenzoic acid (CAS 2183910-38-3) is a chemical compound with the molecular formula C8H6ClNO6S and a molecular weight of 279.65 g/mol. IUPAC name: 2-chloro-5-methylsulfonyl-3-nitrobenzoic acid. InChIKey: SETAJBBWEKWCRK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO6S |
|---|---|
| Molecular weight | 279.65 g/mol |
| IUPAC name | 2-chloro-5-methylsulfonyl-3-nitrobenzoic acid |
| InChIKey | SETAJBBWEKWCRK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)