Products 1547131-56-5
CAS 1547131-56-5 appears in our catalog under these names: 2-(4-Aminophenyl)-3-(4-bromophenyl)propanoic acid, 95%, 2-(4-Aminophenyl)-3-(4-bromophenyl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-(4-aminophenyl)-3-(4-bromophenyl)propanoic acid (CAS 1547131-56-5) is a chemical compound with the molecular formula C15H14BrNO2 and a molecular weight of 320.18 g/mol. IUPAC name: 2-(4-aminophenyl)-3-(4-bromophenyl)propanoic acid. InChIKey: ORBOZDPKLINAJR-UHFFFAOYSA-N.
| Molecular formula | C15H14BrNO2 |
|---|---|
| Molecular weight | 320.18 g/mol |
| IUPAC name | 2-(4-aminophenyl)-3-(4-bromophenyl)propanoic acid |
| InChIKey | ORBOZDPKLINAJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C2=CC=C(C=C2)N)C(=O)O)Br |
Computed by PubChem (NCBI)