CAS 1951444-81-7 is the registry number for Methyl 2-((2-bromo-5-methylphenyl)amino)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Methyl 2-(2-bromo-5-methylanilino)benzoate (CAS 1951444-81-7) is a chemical compound with the molecular formula C15H14BrNO2 and a molecular weight of 320.18 g/mol. IUPAC name: methyl 2-(2-bromo-5-methylanilino)benzoate. InChIKey: IMAAEIXZAMESIJ-UHFFFAOYSA-N.
| Molecular formula | C15H14BrNO2 |
|---|---|
| Molecular weight | 320.18 g/mol |
| IUPAC name | methyl 2-(2-bromo-5-methylanilino)benzoate |
| InChIKey | IMAAEIXZAMESIJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Br)NC2=CC=CC=C2C(=O)OC |
Computed by PubChem (NCBI)