Products 154714-31-5

CAS 154714-31-5 is the registry number for N-Desthienylethyl Rotigotine Sulfate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(6S)-6-(propylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] hydrogen sulfate (CAS 154714-31-5) is a chemical compound with the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. IUPAC name: [(6S)-6-(propylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] hydrogen sulfate. InChIKey: UXGLIJAWVYRZNF-NSHDSACASA-N.

Identity
Molecular formulaC13H19NO4S
Molecular weight285.36 g/mol
IUPAC name[(6S)-6-(propylamino)-5,6,7,8-tetrahydronaphthalen-1-yl] hydrogen sulfate
InChIKeyUXGLIJAWVYRZNF-NSHDSACASA-N
SMILESCCCN[C@H]1CCC2=C(C1)C=CC=C2OS(=O)(=O)O

Computed by PubChem (NCBI)