Products 15482-63-0
CAS 15482-63-0 is the registry number for 4-Methoxy-N,N-dimethylbenzothioamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-methoxy-N,N-dimethylbenzenecarbothioamide (CAS 15482-63-0) is a chemical compound with the molecular formula C10H13NOS and a molecular weight of 195.28 g/mol. IUPAC name: 4-methoxy-N,N-dimethylbenzenecarbothioamide. InChIKey: DSGZADFUTPZEMZ-UHFFFAOYSA-N.
| Molecular formula | C10H13NOS |
|---|---|
| Molecular weight | 195.28 g/mol |
| IUPAC name | 4-methoxy-N,N-dimethylbenzenecarbothioamide |
| InChIKey | DSGZADFUTPZEMZ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)