CAS 154820-97-0 is the registry number for 5-Phenyl-1-pentenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4,4,5,5-tetramethyl-2-[(E)-5-phenylpent-1-enyl]-1,3,2-dioxaborolane (CAS 154820-97-0) is a chemical compound with the molecular formula C17H25BO2 and a molecular weight of 272.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(E)-5-phenylpent-1-enyl]-1,3,2-dioxaborolane. InChIKey: HLUHQMVNJDKHRO-GXDHUFHOSA-N.
| Molecular formula | C17H25BO2 |
|---|---|
| Molecular weight | 272.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(E)-5-phenylpent-1-enyl]-1,3,2-dioxaborolane |
| InChIKey | HLUHQMVNJDKHRO-GXDHUFHOSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCCC2=CC=CC=C2 |
Computed by PubChem (NCBI)