Products 154820-97-0

CAS 154820-97-0 is the registry number for 5-Phenyl-1-pentenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

4,4,5,5-tetramethyl-2-[(E)-5-phenylpent-1-enyl]-1,3,2-dioxaborolane (CAS 154820-97-0) is a chemical compound with the molecular formula C17H25BO2 and a molecular weight of 272.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(E)-5-phenylpent-1-enyl]-1,3,2-dioxaborolane. InChIKey: HLUHQMVNJDKHRO-GXDHUFHOSA-N.

Identity
Molecular formulaC17H25BO2
Molecular weight272.2 g/mol
IUPAC name4,4,5,5-tetramethyl-2-[(E)-5-phenylpent-1-enyl]-1,3,2-dioxaborolane
InChIKeyHLUHQMVNJDKHRO-GXDHUFHOSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)/C=C/CCCC2=CC=CC=C2

Computed by PubChem (NCBI)