Products 2121514-72-3
CAS 2121514-72-3 appears in our catalog under these names: 3-Cyclopentylphenylboronic acid pinacol ester, 3-Cyclopentylphenylboronic acid pinacol ester, 95%, 2-(3-Cyclopentylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 250mg, 500mg, 5g, 1g.
2-(3-cyclopentylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-72-3) is a chemical compound with the molecular formula C17H25BO2 and a molecular weight of 272.2 g/mol. IUPAC name: 2-(3-cyclopentylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JFPBIWOLFRJEQC-UHFFFAOYSA-N.
| Molecular formula | C17H25BO2 |
|---|---|
| Molecular weight | 272.2 g/mol |
| IUPAC name | 2-(3-cyclopentylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JFPBIWOLFRJEQC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3CCCC3 |
Computed by PubChem (NCBI)