CAS 154928-56-0 is the registry number for 1,2-Bis(4-hydroxyphenyl)-2-hydroxypropane. Offered by: TRC. Available pack sizes: 500mg.
1,2-bis(4-hydroxyphenyl)propan-2-ol is a member of phenols and a secondary alcohol. It has a role as a mouse metabolite.
Source: ChEBI
| Molecular formula | C15H16O3 |
|---|---|
| Molecular weight | 244.28 g/mol |
| IUPAC name | 4-[2-hydroxy-2-(4-hydroxyphenyl)propyl]phenol |
| InChIKey | ODPHPWGPPAECAJ-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)O)(C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)