Products 154934-13-1

CAS 154934-13-1 is the registry number for Diethyl 2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Diethyl 2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarboxylate (CAS 154934-13-1) is a chemical compound with the molecular formula C12H14O6S and a molecular weight of 286.30 g/mol. IUPAC name: diethyl 2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarboxylate. InChIKey: BLYQDJZMMFOERZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O6S
Molecular weight286.30 g/mol
IUPAC namediethyl 2,3-dihydrothieno[3,4-b][1,4]dioxine-5,7-dicarboxylate
InChIKeyBLYQDJZMMFOERZ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C2C(=C(S1)C(=O)OCC)OCCO2

Computed by PubChem (NCBI)