CAS 926204-58-2 is the registry number for 3-(3,4-Dihydro-2H-1,5-benzodioxepine-7-sulfonyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)propanoic acid (CAS 926204-58-2) is a chemical compound with the molecular formula C12H14O6S and a molecular weight of 286.30 g/mol. IUPAC name: 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)propanoic acid. InChIKey: ZUBRSJTYKYZRJW-UHFFFAOYSA-N.
| Molecular formula | C12H14O6S |
|---|---|
| Molecular weight | 286.30 g/mol |
| IUPAC name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonyl)propanoic acid |
| InChIKey | ZUBRSJTYKYZRJW-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)S(=O)(=O)CCC(=O)O)OC1 |
Computed by PubChem (NCBI)