Products 1549400-77-2
CAS 1549400-77-2 is the registry number for 1-bromo-2-methyl-4-((4-methylbenzyl)oxy)benzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-methyl-4-[(4-methylphenyl)methoxy]benzene (CAS 1549400-77-2) is a chemical compound with the molecular formula C15H15BrO and a molecular weight of 291.18 g/mol. IUPAC name: 1-bromo-2-methyl-4-[(4-methylphenyl)methoxy]benzene. InChIKey: ARXAZZYCLHWWSL-UHFFFAOYSA-N.
| Molecular formula | C15H15BrO |
|---|---|
| Molecular weight | 291.18 g/mol |
| IUPAC name | 1-bromo-2-methyl-4-[(4-methylphenyl)methoxy]benzene |
| InChIKey | ARXAZZYCLHWWSL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)COC2=CC(=C(C=C2)Br)C |
Computed by PubChem (NCBI)