CAS 1549944-68-4 is the registry number for Topiroxostat Impurity 61. Offered by: Chemat Brand. Available pack sizes: on request.
N-[[amino-(1-oxidopyridin-1-ium-4-yl)methylidene]amino]pyridine-4-carboxamide (CAS 1549944-68-4) is a chemical compound with the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. IUPAC name: N-[[amino-(1-oxidopyridin-1-ium-4-yl)methylidene]amino]pyridine-4-carboxamide. InChIKey: SJUYJDLAINYLFV-UHFFFAOYSA-N.
| Molecular formula | C12H11N5O2 |
|---|---|
| Molecular weight | 257.25 g/mol |
| IUPAC name | N-[[amino-(1-oxidopyridin-1-ium-4-yl)methylidene]amino]pyridine-4-carboxamide |
| InChIKey | SJUYJDLAINYLFV-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C(=O)NN=C(C2=CC=[N+](C=C2)[O-])N |
Computed by PubChem (NCBI)