Products 2925072-56-4
CAS 2925072-56-4 is the registry number for CRBN ligand-323. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(8-aminophthalazin-6-yl)-1,3-diazinane-2,4-dione (CAS 2925072-56-4) is a chemical compound with the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. IUPAC name: 1-(8-aminophthalazin-6-yl)-1,3-diazinane-2,4-dione. InChIKey: QZLHTMCBFJHGFC-UHFFFAOYSA-N.
| Molecular formula | C12H11N5O2 |
|---|---|
| Molecular weight | 257.25 g/mol |
| IUPAC name | 1-(8-aminophthalazin-6-yl)-1,3-diazinane-2,4-dione |
| InChIKey | QZLHTMCBFJHGFC-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC3=CN=NC=C3C(=C2)N |
Computed by PubChem (NCBI)