CAS 1550021-47-0 is the registry number for 2-(Furan-2-yl)-1H-1,3-benzodiazole-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(furan-2-yl)-3H-benzimidazole-5-carbonitrile (CAS 1550021-47-0) is a chemical compound with the molecular formula C12H7N3O and a molecular weight of 209.20 g/mol. IUPAC name: 2-(furan-2-yl)-3H-benzimidazole-5-carbonitrile. InChIKey: YYOGXTRQEAGSJK-UHFFFAOYSA-N.
| Molecular formula | C12H7N3O |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 2-(furan-2-yl)-3H-benzimidazole-5-carbonitrile |
| InChIKey | YYOGXTRQEAGSJK-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NC3=C(N2)C=C(C=C3)C#N |
Computed by PubChem (NCBI)