CAS 256348-47-7 is the registry number for 10H-[1,2,5]Oxadiazolo[3,4-a]carbazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3H-[1,2,5]oxadiazolo[3,4-a]carbazole (CAS 256348-47-7) is a chemical compound with the molecular formula C12H7N3O and a molecular weight of 209.20 g/mol. IUPAC name: 3H-[1,2,5]oxadiazolo[3,4-a]carbazole. InChIKey: VRHNMXUUNKLEMG-UHFFFAOYSA-N.
| Molecular formula | C12H7N3O |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 3H-[1,2,5]oxadiazolo[3,4-a]carbazole |
| InChIKey | VRHNMXUUNKLEMG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=C4C(=NON4)C3=N2 |
Computed by PubChem (NCBI)