Products 15502-50-8

CAS 15502-50-8 is the registry number for 1,2,4,5-Tetramethylbenzene-d14, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

1,4-dideuterio-2,3,5,6-tetrakis(trideuteriomethyl)benzene (CAS 15502-50-8) is a chemical compound with the molecular formula C10H14 and a molecular weight of 148.30 g/mol. IUPAC name: 1,4-dideuterio-2,3,5,6-tetrakis(trideuteriomethyl)benzene. InChIKey: SQNZJJAZBFDUTD-ZVEBFXSZSA-N.

Identity
Molecular formulaC10H14
Molecular weight148.30 g/mol
IUPAC name1,4-dideuterio-2,3,5,6-tetrakis(trideuteriomethyl)benzene
InChIKeySQNZJJAZBFDUTD-ZVEBFXSZSA-N
SMILES[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H]

Computed by PubChem (NCBI)