Products 1859-01-4

CAS 1859-01-4 is the registry number for 1,2,4,5-Tetramethylbenzene-3,6-d2, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

1,4-dideuterio-2,3,5,6-tetramethylbenzene (CAS 1859-01-4) is a chemical compound with the molecular formula C10H14 and a molecular weight of 136.23 g/mol. IUPAC name: 1,4-dideuterio-2,3,5,6-tetramethylbenzene. InChIKey: SQNZJJAZBFDUTD-KCZCTXNHSA-N.

Identity
Molecular formulaC10H14
Molecular weight136.23 g/mol
IUPAC name1,4-dideuterio-2,3,5,6-tetramethylbenzene
InChIKeySQNZJJAZBFDUTD-KCZCTXNHSA-N
SMILES[2H]C1=C(C(=C(C(=C1C)C)[2H])C)C

Computed by PubChem (NCBI)