Products 1550823-05-6

CAS 1550823-05-6 is the registry number for 4-Chloro-1,3,5-triazine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-chloro-1,3,5-triazine-2-carboxylic acid (CAS 1550823-05-6) is a chemical compound with the molecular formula C4H2ClN3O2 and a molecular weight of 159.53 g/mol. IUPAC name: 4-chloro-1,3,5-triazine-2-carboxylic acid. InChIKey: MTWSWQNYNXCRMJ-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2ClN3O2
Molecular weight159.53 g/mol
IUPAC name4-chloro-1,3,5-triazine-2-carboxylic acid
InChIKeyMTWSWQNYNXCRMJ-UHFFFAOYSA-N
SMILESC1=NC(=NC(=N1)Cl)C(=O)O

Computed by PubChem (NCBI)