CAS 87885-45-8 appears in our catalog under these names: 2-Chloro-5-nitropyrazine 95%, 2-Chloro-5-nitropyrazine, 95%, 95%, 2-Chloro-5-nitropyrazine, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2-chloro-5-nitropyrazine (CAS 87885-45-8) is a chemical compound with the molecular formula C4H2ClN3O2 and a molecular weight of 159.53 g/mol. IUPAC name: 2-chloro-5-nitropyrazine. InChIKey: LONXFNWBWBLJNP-UHFFFAOYSA-N.
| Molecular formula | C4H2ClN3O2 |
|---|---|
| Molecular weight | 159.53 g/mol |
| IUPAC name | 2-chloro-5-nitropyrazine |
| InChIKey | LONXFNWBWBLJNP-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)