CAS 15513-52-7 appears in our catalog under these names: 2,6–Dimethyl–3–nitropyridine, 2,6-Dimethyl-3-nitropyridine, >98.0%(GC)(T), 2,6-Dimethyl-3-nitropyridine 98%, 2,6-Dimethyl-3-nitropyridine, 98%, 98%, 2,6-Dimethyl-3-nitropyridine, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
2,6-dimethyl-3-nitropyridine (CAS 15513-52-7) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 2,6-dimethyl-3-nitropyridine. InChIKey: AETHUDGJSSKZKT-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | 2,6-dimethyl-3-nitropyridine |
| InChIKey | AETHUDGJSSKZKT-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1)[N+](=O)[O-])C |
Computed by PubChem (NCBI)