CAS 1551362-55-0 is the registry number for 2,2,2-Trifluoroethyl N-(6-chloropyridin-3-yl)carbamate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,2,2-trifluoroethyl N-(6-chloro-3-pyridinyl)carbamate (CAS 1551362-55-0) is a chemical compound with the molecular formula C8H6ClF3N2O2 and a molecular weight of 254.59 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(6-chloro-3-pyridinyl)carbamate. InChIKey: ZDQLDEOJSHAOGN-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3N2O2 |
|---|---|
| Molecular weight | 254.59 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(6-chloro-3-pyridinyl)carbamate |
| InChIKey | ZDQLDEOJSHAOGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1NC(=O)OCC(F)(F)F)Cl |
Computed by PubChem (NCBI)