Products 923155-43-5
CAS 923155-43-5 is the registry number for 2-[3-Chloro-2-oxo-5-(trifluoromethyl)pyridin-1-yl]acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (CAS 923155-43-5) is a chemical compound with the molecular formula C8H6ClF3N2O2 and a molecular weight of 254.59 g/mol. IUPAC name: 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide. InChIKey: OWGYYALBMAJPKY-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3N2O2 |
|---|---|
| Molecular weight | 254.59 g/mol |
| IUPAC name | 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| InChIKey | OWGYYALBMAJPKY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)N(C=C1C(F)(F)F)CC(=O)N)Cl |
Computed by PubChem (NCBI)