CAS 155138-25-3 appears in our catalog under these names: 2-(4-Chlorophenyl)morpholine Hydrochloride, 95%, 95%, 2-(4-chlorophenyl)morpholine,hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-(4-chlorophenyl)morpholine;hydrochloride (CAS 155138-25-3) is a chemical compound with the molecular formula C10H13Cl2NO and a molecular weight of 234.12 g/mol. IUPAC name: 2-(4-chlorophenyl)morpholine;hydrochloride. InChIKey: VUEDLLVHFJZRCC-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO |
|---|---|
| Molecular weight | 234.12 g/mol |
| IUPAC name | 2-(4-chlorophenyl)morpholine;hydrochloride |
| InChIKey | VUEDLLVHFJZRCC-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)