CAS 90869-66-2 appears in our catalog under these names: 1-(2-Chlorophenyl)-2-(methylamino)-1-propanone Monohydrochloride, 2-CMC (hydrochloride), 1-(2-Chlorophenyl)-2-(methylamino)propan-1-one hydrochloride. Offered by: TRC, MedChemExpress, Biosynth. Available pack sizes: 100mg, 5 mg, 1 mg, 0,5g, 50mg.
1-(2-chlorophenyl)-2-(methylamino)propan-1-one;hydrochloride (CAS 90869-66-2) is a chemical compound with the molecular formula C10H13Cl2NO and a molecular weight of 234.12 g/mol. IUPAC name: 1-(2-chlorophenyl)-2-(methylamino)propan-1-one;hydrochloride. InChIKey: RMOPJSWYMQGLJP-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO |
|---|---|
| Molecular weight | 234.12 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2-(methylamino)propan-1-one;hydrochloride |
| InChIKey | RMOPJSWYMQGLJP-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=CC=C1Cl)NC.Cl |
Computed by PubChem (NCBI)