Products 1551481-37-8

CAS 1551481-37-8 appears in our catalog under these names: 2-Ethoxy-2-(oxolan-3-yl)acetic acid, 95%, 2-Ethoxy-2-(oxolan-3-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-ethoxy-2-(oxolan-3-yl)acetic acid (CAS 1551481-37-8) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 174.19 g/mol. IUPAC name: 2-ethoxy-2-(oxolan-3-yl)acetic acid. InChIKey: HBWQQGBTYDZQDX-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14O4
Molecular weight174.19 g/mol
IUPAC name2-ethoxy-2-(oxolan-3-yl)acetic acid
InChIKeyHBWQQGBTYDZQDX-UHFFFAOYSA-N
SMILESCCOC(C1CCOC1)C(=O)O

Computed by PubChem (NCBI)