CAS 15516-45-7 is the registry number for (2,4-Dimethylphenoxy)acetyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(2,4-dimethylphenoxy)acetyl chloride (CAS 15516-45-7) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 2-(2,4-dimethylphenoxy)acetyl chloride. InChIKey: XJEVVWZVAMVWKS-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 2-(2,4-dimethylphenoxy)acetyl chloride |
| InChIKey | XJEVVWZVAMVWKS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC(=O)Cl)C |
Computed by PubChem (NCBI)