Products 15516-45-7

CAS 15516-45-7 is the registry number for (2,4-Dimethylphenoxy)acetyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2,4-dimethylphenoxy)acetyl chloride (CAS 15516-45-7) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 2-(2,4-dimethylphenoxy)acetyl chloride. InChIKey: XJEVVWZVAMVWKS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO2
Molecular weight198.64 g/mol
IUPAC name2-(2,4-dimethylphenoxy)acetyl chloride
InChIKeyXJEVVWZVAMVWKS-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)OCC(=O)Cl)C

Computed by PubChem (NCBI)