CAS 155206-74-9 is the registry number for 4,5-Dimethoxy-2-phenylbenzaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4,5-dimethoxy-2-phenylbenzaldehyde (CAS 155206-74-9) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 4,5-dimethoxy-2-phenylbenzaldehyde. InChIKey: YFZXKIZPCXCRBW-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 4,5-dimethoxy-2-phenylbenzaldehyde |
| InChIKey | YFZXKIZPCXCRBW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)C2=CC=CC=C2)OC |
Computed by PubChem (NCBI)