CAS 155225-26-6 appears in our catalog under these names: Cyclo(-ala-ser), 95%, (S)-3-(Hydroxymethyl)-1-methylpiperazine-2,5-dione, 95+%, Cyclo(–Ala–Ser), (S)-3-(Hydroxymethyl)-1-methylpiperazine-2,5-dione, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
(3S,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione (CAS 155225-26-6) is a chemical compound with the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. IUPAC name: (3S,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione. InChIKey: JJDWARJCLFFKRT-IMJSIDKUSA-N.
| Molecular formula | C6H10N2O3 |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | (3S,6S)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione |
| InChIKey | JJDWARJCLFFKRT-IMJSIDKUSA-N |
| SMILES | C[C@H]1C(=O)N[C@H](C(=O)N1)CO |
Computed by PubChem (NCBI)