Products 2387929-00-0
CAS 2387929-00-0 is the registry number for (3R,6R)-3-(Hydroxymethyl)-6-methylpiperazine-2,5-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,6R)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione (CAS 2387929-00-0) is a chemical compound with the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. IUPAC name: (3R,6R)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione. InChIKey: JJDWARJCLFFKRT-QWWZWVQMSA-N.
| Molecular formula | C6H10N2O3 |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | (3R,6R)-3-(hydroxymethyl)-6-methylpiperazine-2,5-dione |
| InChIKey | JJDWARJCLFFKRT-QWWZWVQMSA-N |
| SMILES | C[C@@H]1C(=O)N[C@@H](C(=O)N1)CO |
Computed by PubChem (NCBI)