Products 1552532-10-1

CAS 1552532-10-1 is the registry number for 3-Amino-7-fluoro-1-benzothiophene-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-amino-7-fluoro-1-benzothiophene-2-carboxylic acid (CAS 1552532-10-1) is a chemical compound with the molecular formula C9H6FNO2S and a molecular weight of 211.21 g/mol. IUPAC name: 3-amino-7-fluoro-1-benzothiophene-2-carboxylic acid. InChIKey: UETLINNQLKWVRT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6FNO2S
Molecular weight211.21 g/mol
IUPAC name3-amino-7-fluoro-1-benzothiophene-2-carboxylic acid
InChIKeyUETLINNQLKWVRT-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)F)SC(=C2N)C(=O)O

Computed by PubChem (NCBI)