Products 1780722-00-0
CAS 1780722-00-0 is the registry number for 4-Fluoro-2-methylbenzo[d]thiazole-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-2-methyl-1,3-benzothiazole-6-carboxylic acid (CAS 1780722-00-0) is a chemical compound with the molecular formula C9H6FNO2S and a molecular weight of 211.21 g/mol. IUPAC name: 4-fluoro-2-methyl-1,3-benzothiazole-6-carboxylic acid. InChIKey: RXKZVLFGCZJJIM-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2S |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 4-fluoro-2-methyl-1,3-benzothiazole-6-carboxylic acid |
| InChIKey | RXKZVLFGCZJJIM-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2S1)C(=O)O)F |
Computed by PubChem (NCBI)