CAS 1552801-85-0 is the registry number for 2-(Methylsulfonyl)thiazole-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylsulfonyl-1,3-thiazole-4-carboxylic acid (CAS 1552801-85-0) is a chemical compound with the molecular formula C5H5NO4S2 and a molecular weight of 207.2 g/mol. IUPAC name: 2-methylsulfonyl-1,3-thiazole-4-carboxylic acid. InChIKey: OCYCFSIZZZZATE-UHFFFAOYSA-N.
| Molecular formula | C5H5NO4S2 |
|---|---|
| Molecular weight | 207.2 g/mol |
| IUPAC name | 2-methylsulfonyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | OCYCFSIZZZZATE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC(=CS1)C(=O)O |
Computed by PubChem (NCBI)