CAS 59337-97-2 appears in our catalog under these names: 3-Sulfamoylthiophene-2-carboxylic acid, 95+%, 3-(aminosulfonyl)-2-thiophenecarboxylic acid, 95+%, 3-(Aminosulfonyl)thiophene-2-carboxylic acid, 95%, 3-(Aminosulfonyl)thiophene-2-carboxylic Acid, >95% (HPLC), 3-(aminosulfonyl)thiophene-2-carboxylic acid, 95+%, 95+%. Offered by: AmBeed, Fluorochem, Combi-blocks, TRC, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg, 50mg.
3-sulfamoylthiophene-2-carboxylic acid (CAS 59337-97-2) is a chemical compound with the molecular formula C5H5NO4S2 and a molecular weight of 207.2 g/mol. IUPAC name: 3-sulfamoylthiophene-2-carboxylic acid. InChIKey: NRAVSUNXRBRPRE-UHFFFAOYSA-N.
| Molecular formula | C5H5NO4S2 |
|---|---|
| Molecular weight | 207.2 g/mol |
| IUPAC name | 3-sulfamoylthiophene-2-carboxylic acid |
| InChIKey | NRAVSUNXRBRPRE-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)