Products 155307-62-3

CAS 155307-62-3 is the registry number for L-LACTIC ACID-3-13C, >=99 ATOM % 13C, 9&. Offered by: Sigma-Aldrich. Available pack sizes: 1G.

Structural formula: {0} (CAS {1})

(2S)-2-hydroxy(313C)propanoic acid (CAS 155307-62-3) is a chemical compound with the molecular formula C3H6O3 and a molecular weight of 91.07 g/mol. IUPAC name: (2S)-2-hydroxy(313C)propanoic acid. InChIKey: JVTAAEKCZFNVCJ-IJGDANSWSA-N.

Identity
Molecular formulaC3H6O3
Molecular weight91.07 g/mol
IUPAC name(2S)-2-hydroxy(313C)propanoic acid
InChIKeyJVTAAEKCZFNVCJ-IJGDANSWSA-N
SMILES[13CH3][C@@H](C(=O)O)O

Computed by PubChem (NCBI)