Products 87684-87-5
CAS 87684-87-5 appears in our catalog under these names: L–Lactic acid–13C3, L-Lactic acid-¹³C₃, L-Lactic acid-13C3, 99.9%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 100mg, 10 mg, 5 mg, 1 mg.
(2S)-2-hydroxy(1,2,3-13C3)propanoic acid (CAS 87684-87-5) is a chemical compound with the molecular formula C3H6O3 and a molecular weight of 93.056 g/mol. IUPAC name: (2S)-2-hydroxy(1,2,3-13C3)propanoic acid. InChIKey: JVTAAEKCZFNVCJ-GCCOVPGMSA-N.
| Molecular formula | C3H6O3 |
|---|---|
| Molecular weight | 93.056 g/mol |
| IUPAC name | (2S)-2-hydroxy(1,2,3-13C3)propanoic acid |
| InChIKey | JVTAAEKCZFNVCJ-GCCOVPGMSA-N |
| SMILES | [13CH3][13C@@H]([13C](=O)O)O |
Computed by PubChem (NCBI)