Products 1553415-03-4
CAS 1553415-03-4 is the registry number for 2-(5-bromo-2-fluorophenyl)-1,1,1-trifluoropropan-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(5-bromo-2-fluorophenyl)-1,1,1-trifluoropropan-2-ol (CAS 1553415-03-4) is a chemical compound with the molecular formula C9H7BrF4O and a molecular weight of 287.05 g/mol. IUPAC name: 2-(5-bromo-2-fluorophenyl)-1,1,1-trifluoropropan-2-ol. InChIKey: VNIXFBVWTXFYEB-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF4O |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | 2-(5-bromo-2-fluorophenyl)-1,1,1-trifluoropropan-2-ol |
| InChIKey | VNIXFBVWTXFYEB-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1)Br)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)