CAS 67033-41-4 is the registry number for 1-(Bromomethyl)-4-(1,1,2,2-tetrafluoroethoxy)benzene. Offered by: TRC, Biosynth. Available pack sizes: 10g, 1g, 5g.
1-(bromomethyl)-4-(1,1,2,2-tetrafluoroethoxy)benzene (CAS 67033-41-4) is a chemical compound with the molecular formula C9H7BrF4O and a molecular weight of 287.05 g/mol. IUPAC name: 1-(bromomethyl)-4-(1,1,2,2-tetrafluoroethoxy)benzene. InChIKey: MZTLKRLBGMLXEL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF4O |
|---|---|
| Molecular weight | 287.05 g/mol |
| IUPAC name | 1-(bromomethyl)-4-(1,1,2,2-tetrafluoroethoxy)benzene |
| InChIKey | MZTLKRLBGMLXEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)OC(C(F)F)(F)F |
Computed by PubChem (NCBI)