Products 1553962-58-5
CAS 1553962-58-5 is the registry number for 3-Cyclobutyl-1H-1,2,4-triazole-5-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-cyclobutyl-1H-1,2,4-triazole-3-carboxylic acid (CAS 1553962-58-5) is a chemical compound with the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. IUPAC name: 5-cyclobutyl-1H-1,2,4-triazole-3-carboxylic acid. InChIKey: WXNCMUHJNCEWLD-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O2 |
|---|---|
| Molecular weight | 167.17 g/mol |
| IUPAC name | 5-cyclobutyl-1H-1,2,4-triazole-3-carboxylic acid |
| InChIKey | WXNCMUHJNCEWLD-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C2=NC(=NN2)C(=O)O |
Computed by PubChem (NCBI)