CAS 15540-91-7 appears in our catalog under these names: 2-Amino-3,6-dimethylbenzoic acid, 97%, 2-Amino-3,6-dimethylbenzoic acid, 2-Amino-3,6-dimethylbenzoic acid 97%, 2-amino-3,6-dimethylbenzoic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 25g, 1g, 10g, 5g, 2,5g.
2-amino-3,6-dimethylbenzoic acid (CAS 15540-91-7) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 2-amino-3,6-dimethylbenzoic acid. InChIKey: PFKMPZBEUUAELA-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 2-amino-3,6-dimethylbenzoic acid |
| InChIKey | PFKMPZBEUUAELA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C)N)C(=O)O |
Computed by PubChem (NCBI)