CAS 1554344-28-3 is the registry number for 5-(tert-Butyl)-4-chloroisoxazole-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-tert-butyl-4-chloro-1,2-oxazole-3-carbaldehyde (CAS 1554344-28-3) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: 5-tert-butyl-4-chloro-1,2-oxazole-3-carbaldehyde. InChIKey: ZMHHXOSMLPZINY-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2 |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 5-tert-butyl-4-chloro-1,2-oxazole-3-carbaldehyde |
| InChIKey | ZMHHXOSMLPZINY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=NO1)C=O)Cl |
Computed by PubChem (NCBI)