Products 1554459-25-4

CAS 1554459-25-4 is the registry number for 2-(2-(Trifluoromethyl)cyclohexyl)acetic Acid. Offered by: TRC, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-[2-(trifluoromethyl)cyclohexyl]acetic acid (CAS 1554459-25-4) is a chemical compound with the molecular formula C9H13F3O2 and a molecular weight of 210.19 g/mol. IUPAC name: 2-[2-(trifluoromethyl)cyclohexyl]acetic acid. InChIKey: RMMWTSIYTSWRIN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13F3O2
Molecular weight210.19 g/mol
IUPAC name2-[2-(trifluoromethyl)cyclohexyl]acetic acid
InChIKeyRMMWTSIYTSWRIN-UHFFFAOYSA-N
SMILESC1CCC(C(C1)CC(=O)O)C(F)(F)F

Computed by PubChem (NCBI)