CAS 1554459-25-4 is the registry number for 2-(2-(Trifluoromethyl)cyclohexyl)acetic Acid. Offered by: TRC, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[2-(trifluoromethyl)cyclohexyl]acetic acid (CAS 1554459-25-4) is a chemical compound with the molecular formula C9H13F3O2 and a molecular weight of 210.19 g/mol. IUPAC name: 2-[2-(trifluoromethyl)cyclohexyl]acetic acid. InChIKey: RMMWTSIYTSWRIN-UHFFFAOYSA-N.
| Molecular formula | C9H13F3O2 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)cyclohexyl]acetic acid |
| InChIKey | RMMWTSIYTSWRIN-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)