CAS 27705-12-0 is the registry number for rel-Methyl (1S,3R)-3-(trifluoromethyl)cyclohexane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-methyl (1S,3R)-3-(trifluoromethyl)cyclohexane-1-carboxylate (CAS 27705-12-0) is a chemical compound with the molecular formula C9H13F3O2 and a molecular weight of 210.19 g/mol. IUPAC name: cis-methyl (1S,3R)-3-(trifluoromethyl)cyclohexane-1-carboxylate. InChIKey: SQPPVXPLDGRDTH-NKWVEPMBSA-N.
| Molecular formula | C9H13F3O2 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | cis-methyl (1S,3R)-3-(trifluoromethyl)cyclohexane-1-carboxylate |
| InChIKey | SQPPVXPLDGRDTH-NKWVEPMBSA-N |
| SMILES | COC(=O)[C@H]1CCC[C@H](C1)C(F)(F)F |
Computed by PubChem (NCBI)