Products 1555336-67-8

CAS 1555336-67-8 is the registry number for 5-Methanesulfonyl-1-methyl-1H-indole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-methyl-5-methylsulfonylindole-3-carboxylic acid (CAS 1555336-67-8) is a chemical compound with the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. IUPAC name: 1-methyl-5-methylsulfonylindole-3-carboxylic acid. InChIKey: WFNJBFORSMOQEH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO4S
Molecular weight253.28 g/mol
IUPAC name1-methyl-5-methylsulfonylindole-3-carboxylic acid
InChIKeyWFNJBFORSMOQEH-UHFFFAOYSA-N
SMILESCN1C=C(C2=C1C=CC(=C2)S(=O)(=O)C)C(=O)O

Computed by PubChem (NCBI)