CAS 1980063-87-3 is the registry number for 3-[4-(Methoxycarbonyl)-1,3-thiazol-2-yl]bicyclo[1.1.1]pentane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
3-(4-methoxycarbonyl-1,3-thiazol-2-yl)bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 1980063-87-3) is a chemical compound with the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. IUPAC name: 3-(4-methoxycarbonyl-1,3-thiazol-2-yl)bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: SAKLNOFLETUPPU-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4S |
|---|---|
| Molecular weight | 253.28 g/mol |
| IUPAC name | 3-(4-methoxycarbonyl-1,3-thiazol-2-yl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | SAKLNOFLETUPPU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C23CC(C2)(C3)C(=O)O |
Computed by PubChem (NCBI)