CAS 1555560-66-1 is the registry number for 3-Fluoro-N-methyl-4-nitrobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-fluoro-N-methyl-4-nitrobenzenesulfonamide (CAS 1555560-66-1) is a chemical compound with the molecular formula C7H7FN2O4S and a molecular weight of 234.21 g/mol. IUPAC name: 3-fluoro-N-methyl-4-nitrobenzenesulfonamide. InChIKey: KIEYTFGALTUGTE-UHFFFAOYSA-N.
| Molecular formula | C7H7FN2O4S |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 3-fluoro-N-methyl-4-nitrobenzenesulfonamide |
| InChIKey | KIEYTFGALTUGTE-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC(=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)